ohhkwen4365 ohhkwen4365
  • 02-11-2017
  • History
contestada

How the korean war affect us korean relations in present day?

Respuesta :

98cholmes
98cholmes 98cholmes
  • 03-11-2017
The Korean War was fought between the Russians (Soviets) and the US; using North & South Koreans, and free world troops, and using the peninsula of Korea (the country of Korea) as a battleground. The Soviet Union and United States TESTED there equipment against each other. Korea was a testing ground between the US & Soviets.
Answer Link

Otras preguntas

Where was the first labor day parade held?
Simplify the expression x18
Why do you think the Gracchus brothers were killed?
Using the addition or subtraction formulas for sine or cosine... sin(a)sin(b)=(sin(a+b)+sin(a-b))/2
What happens during the first trimester?
during the dark and stormy night the trucker's continue down the Steep Canyon is this a simple or compound sentence​
Which federal agency enforces safety and health legislation and requires employers to be sure that adequate first-aid supplies are available? A) Occupational Sa
how did the allies leverage their geographical position after the axis powers surrendered to them in tunisia​
(3 + 8x) + 7x 1. 3 plus 15x 2. 18x 3. 18 plus x 4. 11x plus 7
What is the message or theme of the movie World Trade Center