rapacorn rapacorn

13-03-2021
Geography

contestada

Which of the two categories of religion do you feel is more predominant in your area?

Respuesta :

boiledegg99 boiledegg99

13-03-2021

Answer: Polytheism

Explanation:

I currently live in Thailand where 94.6 % of the population is estimated to be Buddhist. In Buddhism, gods are called deva and live in a separate realm of existence consisting of 27 heavens or svarga.

Answer Link

Otras preguntas

What shape results from a plane passing through a cone that is perpendicular to the base? Isosceles Triangle Circle Parabola Ellipse

HELPPP. What is the equation of the line that passes through the point (6,0) and had a slope of -5/6?

What’s interesting to me in looking—I like history a lot, and looking at old historical documents—is to see that in the 1840s there was still a significant numb

Ron wants to be able to empathize with others. He often doesn't understand why his friends are happy or upset. Which aspect of emotional intelligence should Ron

PLS PLS HELP PLSSSSSSSSSSSSSSSSSSS

Does anybody have a chaptre summary or anything else for the book "Three hours" by Rosamund Lupton

How is political authority related to public policy?

20 POINTS FOR EACH QUESTION PLEASE HELP ME WITH THEM ALL How does the profit motive affect the goals of producers? How is a cost-benefit analysis used to make

Draw the best Lewis structure for CH3CH(CH3)CH2C(CH2CH3)2CHO, a neutral molecule. HELP PLEASE

Please label whether the acceleration is positive, zero, or negative: A-B: B-C: C-D