annetteelias20 annetteelias20

11-09-2020
Mathematics

contestada

Help please !!!
Write the equation of the line if the line passes through (4,4) and the y-intercepts is -4

Respuesta :

cristinacalata22 cristinacalata22

11-09-2020

The equation for this line would be y=2x-4

Answer Link

Otras preguntas

can someone please explain how i do this

What’s MA I need a answer asap if possible

What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2

y=8-x 2x^2 + xy= -16this is A simultaneous equation

You spin the spinner twice. 2 4 3 What is the probability of landing on a 3 and then landing on an odd number? Simplify your answer and write it as a fraction o

10. Simplify:(4x2 - 2x) - (-5x2 - 8x).Fre.e Brainliest for the correct answer

Can someone help me solve this equation?

A polygon has vertices A(3, 3), B(3, 6), and C(9, 3). Find the area of the polygon. NEED IT ASAP

Which of the following is a common requirement of a PhD across different schools and/or countries? A. Earning licensure B. A minimum of three years of coursewor

A patient is ordered 1.6 g Drug A every 8 hours over a 24 hour period, then 1.6 g every 4 hours for the next three days. How many grams of Drug A will the patie